Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
1-Benzo[b]thiophen-3-yl-2-bromoethan-1-one, 97%, Thermo Scientific™
CAS: 26167-45-3 Molecular Formula: C10H7BrOS Molecular Weight (g/mol): 255.129 InChI Key: CKHWNGWAHFLCTJ-UHFFFAOYSA-N Synonym: 1-benzo b thiophen-3-yl-2-bromoethanone,1-benzo b thiophen-3-yl-2-bromoethan-1-one,3-bromoacetyl benzothiophene,1-1-benzothiophen-3-yl-2-bromoethan-1-one,3-bromoacetyl benzo b thiophene,1-1-benzothiophen-3-yl-2-bromoethanone,1-1-benzothiophen-3-yl-2-bromo-1-ethanone,3-2-bromoacetyl benzo b thiophen,1-benzothiophen-3-yl-2-bromo-ethanone,ethanone,1-benzo b thien-3-yl-2-bromo PubChem CID: 2776341 IUPAC Name: 1-(1-benzothiophen-3-yl)-2-bromoethanone SMILES: C1=CC=C2C(=C1)C(=CS2)C(=O)CBr
| PubChem CID | 2776341 |
|---|---|
| CAS | 26167-45-3 |
| Molecular Weight (g/mol) | 255.129 |
| SMILES | C1=CC=C2C(=C1)C(=CS2)C(=O)CBr |
| Synonym | 1-benzo b thiophen-3-yl-2-bromoethanone,1-benzo b thiophen-3-yl-2-bromoethan-1-one,3-bromoacetyl benzothiophene,1-1-benzothiophen-3-yl-2-bromoethan-1-one,3-bromoacetyl benzo b thiophene,1-1-benzothiophen-3-yl-2-bromoethanone,1-1-benzothiophen-3-yl-2-bromo-1-ethanone,3-2-bromoacetyl benzo b thiophen,1-benzothiophen-3-yl-2-bromo-ethanone,ethanone,1-benzo b thien-3-yl-2-bromo |
| IUPAC Name | 1-(1-benzothiophen-3-yl)-2-bromoethanone |
| InChI Key | CKHWNGWAHFLCTJ-UHFFFAOYSA-N |
| Molecular Formula | C10H7BrOS |
6-Hydroxy-2,3-dihydrobenzo[b]furan-3-one, 97%
CAS: 6272-26-0 Molecular Formula: C8H6O3 Molecular Weight (g/mol): 150.13 MDL Number: MFCD00068174 InChI Key: GBDMODVZBPFQKI-UHFFFAOYSA-N Synonym: 6-hydroxybenzofuran-3 2h-one,6-hydroxy-2h-benzofuran-3-one,6-hydroxy-2,3-dihydrobenzo b furan-3-one,6-hydroxy-1-benzofuran-3 2h-one,6-hydroxybenzofuran-3-one,3 2h-benzofuranone, 6-hydroxy,6-hydroxy-3-coumaranone,6-hydroxy-2,3-dihydro-1-benzofuran-3-one,6-hydroxy-3 2h-benzofuranone,6-hydroxy-2h-1-benzofuran-3-one PubChem CID: 235717 IUPAC Name: 6-hydroxy-2,3-dihydro-1-benzofuran-3-one SMILES: OC1=CC=C2C(=O)COC2=C1
| PubChem CID | 235717 |
|---|---|
| CAS | 6272-26-0 |
| Molecular Weight (g/mol) | 150.13 |
| MDL Number | MFCD00068174 |
| SMILES | OC1=CC=C2C(=O)COC2=C1 |
| Synonym | 6-hydroxybenzofuran-3 2h-one,6-hydroxy-2h-benzofuran-3-one,6-hydroxy-2,3-dihydrobenzo b furan-3-one,6-hydroxy-1-benzofuran-3 2h-one,6-hydroxybenzofuran-3-one,3 2h-benzofuranone, 6-hydroxy,6-hydroxy-3-coumaranone,6-hydroxy-2,3-dihydro-1-benzofuran-3-one,6-hydroxy-3 2h-benzofuranone,6-hydroxy-2h-1-benzofuran-3-one |
| IUPAC Name | 6-hydroxy-2,3-dihydro-1-benzofuran-3-one |
| InChI Key | GBDMODVZBPFQKI-UHFFFAOYSA-N |
| Molecular Formula | C8H6O3 |
Polystyrene latex microsphere, 0.05 micron, 2.5 wt% dispersion in water
CAS: 9003-53-6 Molecular Formula: (C8H8)n Molecular Weight (g/mol): 104.15 MDL Number: MFCD00084450 InChI Key: PPBRXRYQALVLMV-UHFFFAOYSA-N Synonym: ethenylbenzene,phenylethylene,vinylbenzene,styrol,benzene, ethenyl,cinnamene,phenylethene,monomer,phenethylene,styrolene PubChem CID: 7501 ChEBI: CHEBI:27452 IUPAC Name: ethenylbenzene SMILES: *-CC(-*)C1=CC=CC=C1
| PubChem CID | 7501 |
|---|---|
| CAS | 9003-53-6 |
| Molecular Weight (g/mol) | 104.15 |
| ChEBI | CHEBI:27452 |
| MDL Number | MFCD00084450 |
| SMILES | *-CC(-*)C1=CC=CC=C1 |
| Synonym | ethenylbenzene,phenylethylene,vinylbenzene,styrol,benzene, ethenyl,cinnamene,phenylethene,monomer,phenethylene,styrolene |
| IUPAC Name | ethenylbenzene |
| InChI Key | PPBRXRYQALVLMV-UHFFFAOYSA-N |
| Molecular Formula | (C8H8)n |
Polystyrene latex microsphere, 1 micron, 2.5 wt% dispersion in water
CAS: 9003-53-6 Molecular Formula: (C8H8)n Molecular Weight (g/mol): 104.15 MDL Number: MFCD00084450 InChI Key: PPBRXRYQALVLMV-UHFFFAOYSA-N Synonym: ethenylbenzene,phenylethylene,vinylbenzene,styrol,benzene, ethenyl,cinnamene,phenylethene,monomer,phenethylene,styrolene PubChem CID: 7501 ChEBI: CHEBI:27452 IUPAC Name: ethenylbenzene SMILES: *-CC(-*)C1=CC=CC=C1
| PubChem CID | 7501 |
|---|---|
| CAS | 9003-53-6 |
| Molecular Weight (g/mol) | 104.15 |
| ChEBI | CHEBI:27452 |
| MDL Number | MFCD00084450 |
| SMILES | *-CC(-*)C1=CC=CC=C1 |
| Synonym | ethenylbenzene,phenylethylene,vinylbenzene,styrol,benzene, ethenyl,cinnamene,phenylethene,monomer,phenethylene,styrolene |
| IUPAC Name | ethenylbenzene |
| InChI Key | PPBRXRYQALVLMV-UHFFFAOYSA-N |
| Molecular Formula | (C8H8)n |
Tetrakis(2,2,6,6-tetramethyl-3,5-heptanedionato)zirconium(IV), 99.99% (metals basis), Thermo Scientific Chemicals
CAS: 18865-74-2 Molecular Formula: C44H80O8Zr Molecular Weight (g/mol): 828.34 MDL Number: MFCD00145380,MFCD00145380 InChI Key: ANBXKEDJQLYCLX-UHFFFAOYSA-N Synonym: tetrakis 2,2,6,6-tetramethyl-3,5-heptanedionato zirconium,zirconium 2,2,6,6-tetramethyl-3,5-heptanedionate,tetrakis 2,2,6,6-tetramethyl-3,5-heptanedionato zirconium iv,zr tmhd 4,zirconium tetrakis 2,2,6,6-tetramethyl-3,5-heptanedionate,zirconium tetrakis dipivaloylmethanate,zirconium iv 2,2,6,6-tetramethyl-3,5-heptanedionate,4z-2,2,6,6-tetramethyl-5-tris 3z-2,2,6,6-tetramethyl-5-oxohept-3-en-3-yl oxy zirconio oxy hept-4-en-3-one PubChem CID: 50919870 IUPAC Name: 5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;zirconium SMILES: [Zr].CC(C)(C)C(O)=CC(=O)C(C)(C)C.CC(C)(C)C(O)=CC(=O)C(C)(C)C.CC(C)(C)C(O)=CC(=O)C(C)(C)C.CC(C)(C)C(O)=CC(=O)C(C)(C)C
| PubChem CID | 50919870 |
|---|---|
| CAS | 18865-74-2 |
| Molecular Weight (g/mol) | 828.34 |
| MDL Number | MFCD00145380,MFCD00145380 |
| SMILES | [Zr].CC(C)(C)C(O)=CC(=O)C(C)(C)C.CC(C)(C)C(O)=CC(=O)C(C)(C)C.CC(C)(C)C(O)=CC(=O)C(C)(C)C.CC(C)(C)C(O)=CC(=O)C(C)(C)C |
| Synonym | tetrakis 2,2,6,6-tetramethyl-3,5-heptanedionato zirconium,zirconium 2,2,6,6-tetramethyl-3,5-heptanedionate,tetrakis 2,2,6,6-tetramethyl-3,5-heptanedionato zirconium iv,zr tmhd 4,zirconium tetrakis 2,2,6,6-tetramethyl-3,5-heptanedionate,zirconium tetrakis dipivaloylmethanate,zirconium iv 2,2,6,6-tetramethyl-3,5-heptanedionate,4z-2,2,6,6-tetramethyl-5-tris 3z-2,2,6,6-tetramethyl-5-oxohept-3-en-3-yl oxy zirconio oxy hept-4-en-3-one |
| IUPAC Name | 5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;zirconium |
| InChI Key | ANBXKEDJQLYCLX-UHFFFAOYSA-N |
| Molecular Formula | C44H80O8Zr |
Iron(III) isopropoxide, 2.5% w/v in isopropanol
CAS: 14995-22-3 Molecular Formula: C9H21FeO3 Molecular Weight (g/mol): 233.109 MDL Number: MFCD00070436 InChI Key: QUHDSMAREWXWFM-UHFFFAOYSA-N Synonym: iron 3+ ;propan-2-olate,iron iii i-propoxide,triisopropoxyiron iii,2-propanol, iron 3+ salt 9ci,iron 3+ ion tris propan-2-olate,iron 3+ tris propan-2-olate,iron iii i-propoxide 99.9+%-fe PubChem CID: 11961763 IUPAC Name: iron(3+);propan-2-olate SMILES: CC(C)[O-].CC(C)[O-].CC(C)[O-].[Fe+3]
| PubChem CID | 11961763 |
|---|---|
| CAS | 14995-22-3 |
| Molecular Weight (g/mol) | 233.109 |
| MDL Number | MFCD00070436 |
| SMILES | CC(C)[O-].CC(C)[O-].CC(C)[O-].[Fe+3] |
| Synonym | iron 3+ ;propan-2-olate,iron iii i-propoxide,triisopropoxyiron iii,2-propanol, iron 3+ salt 9ci,iron 3+ ion tris propan-2-olate,iron 3+ tris propan-2-olate,iron iii i-propoxide 99.9+%-fe |
| IUPAC Name | iron(3+);propan-2-olate |
| InChI Key | QUHDSMAREWXWFM-UHFFFAOYSA-N |
| Molecular Formula | C9H21FeO3 |
Poly(styrene-divinylbenzene), 1% cross-linked, 100-200 mesh, Thermo Scientific Chemicals
CAS: 9003-70-7 Molecular Formula: C24H27NO5 Molecular Weight (g/mol): 409.48 MDL Number: 9003-70-7 InChI Key: BCIPGSZQUDLGSY-UHFFFAOYNA-N Synonym: styrene/divinylbenzen,divinylbenzene-styrene,styrene divinylbenzene,styrene-divinylbenzene,styrene/divinylbenzene,styrene-divinyl benzene,benzene, diethenyl-, polymer with ethenylbenzene, brominated,st dvb,divinylbenzene; styrene,1,2-diethenylbenzene; styrene PubChem CID: 174664 IUPAC Name: 1,2-bis(ethenyl)benzene;styrene SMILES: CC(C)(C)OC(=O)CCC(NC(=O)OCC1C2=CC=CC=C2C2=CC=CC=C12)C=O
| PubChem CID | 174664 |
|---|---|
| CAS | 9003-70-7 |
| Molecular Weight (g/mol) | 409.48 |
| MDL Number | 9003-70-7 |
| SMILES | CC(C)(C)OC(=O)CCC(NC(=O)OCC1C2=CC=CC=C2C2=CC=CC=C12)C=O |
| Synonym | styrene/divinylbenzen,divinylbenzene-styrene,styrene divinylbenzene,styrene-divinylbenzene,styrene/divinylbenzene,styrene-divinyl benzene,benzene, diethenyl-, polymer with ethenylbenzene, brominated,st dvb,divinylbenzene; styrene,1,2-diethenylbenzene; styrene |
| IUPAC Name | 1,2-bis(ethenyl)benzene;styrene |
| InChI Key | BCIPGSZQUDLGSY-UHFFFAOYNA-N |
| Molecular Formula | C24H27NO5 |
Poly(3-hexylthiophene-2,5-diyl), regioregular, low metals, Thermo Scientific Chemicals
CAS: 104934-50-1 Molecular Formula: (C10H14S)n Molecular Weight (g/mol): NaN MDL Number: MFCD00217686 InChI Key: DUFPJSOXRHVDOV-UHFFFAOYSA-N Synonym: poly 3-hexylthiophene-2,5-diyl,3-hexyl-2,5-dimethyl-thiophene,poly 3-hexylthiophene-2,5-diyl , regiorandom,poly 3-hexylthiophene-2,5-diyl , regioregular, low metals,poly 3-hexylthiophene-2,5-diyl , regioregular, mw 34000-41000, rr, electronic grade,poly 3-hexylthiophene-2,5-diyl , regioregular, mw 34000-41000, rr, electronic grade, high purity,poly 3-hexylthiophene-2,5-diyl , regioregular, mw 50000-70000, rr, electronic grade,poly 3-hexylthiophene-2,5-diyl , regioregular, mw 50000-70000, rr, electronic grade, high purity,poly 3-hexylthiophene-2,5-diyl , regioregular, mw 60000-75000, rr or above, electronic grade,poly 3-hexylthiophene-2,5-diyl , regioregular, mw 65000-75000, rr or above, electronic grade, high purity PubChem CID: 22950249 IUPAC Name: 3-hexyl-2,5-dimethylthiophene SMILES: CCCCCCC1=C(-*)SC(-*)=C1
| PubChem CID | 22950249 |
|---|---|
| CAS | 104934-50-1 |
| Molecular Weight (g/mol) | NaN |
| MDL Number | MFCD00217686 |
| SMILES | CCCCCCC1=C(-*)SC(-*)=C1 |
| Synonym | poly 3-hexylthiophene-2,5-diyl,3-hexyl-2,5-dimethyl-thiophene,poly 3-hexylthiophene-2,5-diyl , regiorandom,poly 3-hexylthiophene-2,5-diyl , regioregular, low metals,poly 3-hexylthiophene-2,5-diyl , regioregular, mw 34000-41000, rr, electronic grade,poly 3-hexylthiophene-2,5-diyl , regioregular, mw 34000-41000, rr, electronic grade, high purity,poly 3-hexylthiophene-2,5-diyl , regioregular, mw 50000-70000, rr, electronic grade,poly 3-hexylthiophene-2,5-diyl , regioregular, mw 50000-70000, rr, electronic grade, high purity,poly 3-hexylthiophene-2,5-diyl , regioregular, mw 60000-75000, rr or above, electronic grade,poly 3-hexylthiophene-2,5-diyl , regioregular, mw 65000-75000, rr or above, electronic grade, high purity |
| IUPAC Name | 3-hexyl-2,5-dimethylthiophene |
| InChI Key | DUFPJSOXRHVDOV-UHFFFAOYSA-N |
| Molecular Formula | (C10H14S)n |
1,3-Diiodopropane, 98+%, stab. with copper
CAS: 627-31-6 Molecular Formula: C3H6I2 Molecular Weight (g/mol): 295.89 MDL Number: MFCD00001097 InChI Key: AAAXMNYUNVCMCJ-UHFFFAOYSA-N Synonym: trimethylene diiodide,propane, 1,3-diiodo,trimethylene iodide,propane,3-diiodo,pubchem3858,1,3-bis iodanyl propane,acmc-1av5p,4-01-00-00228 beilstein handbook reference,1,3-diiodopropane, contains copper as stabilizer PubChem CID: 12314 IUPAC Name: 1,3-diiodopropane SMILES: C(CI)CI
| PubChem CID | 12314 |
|---|---|
| CAS | 627-31-6 |
| Molecular Weight (g/mol) | 295.89 |
| MDL Number | MFCD00001097 |
| SMILES | C(CI)CI |
| Synonym | trimethylene diiodide,propane, 1,3-diiodo,trimethylene iodide,propane,3-diiodo,pubchem3858,1,3-bis iodanyl propane,acmc-1av5p,4-01-00-00228 beilstein handbook reference,1,3-diiodopropane, contains copper as stabilizer |
| IUPAC Name | 1,3-diiodopropane |
| InChI Key | AAAXMNYUNVCMCJ-UHFFFAOYSA-N |
| Molecular Formula | C3H6I2 |
N-(4-Nitrophenyl)thiourea, 98%
CAS: 3696-22-8 Molecular Formula: C7H7N3O2S Molecular Weight (g/mol): 197.21 MDL Number: MFCD00007304 InChI Key: BLYAANPIHFKKMQ-UHFFFAOYSA-N Synonym: 1-4-nitrophenyl-2-thiourea,n-4-nitrophenyl thiourea,4-nitrophenyl thiourea,1-4-nitrophenyl thiourea,p-nitrophenyl thiourea,thiourea, 4-nitrophenyl,n-p-nitrophenyl thiourea,acmc-1cny6,4-nitro-phenyl-thiourea,n-4-nitrophenyl thiourea # PubChem CID: 2760234 IUPAC Name: (4-nitrophenyl)thiourea SMILES: NC(=S)NC1=CC=C(C=C1)[N+]([O-])=O
| PubChem CID | 2760234 |
|---|---|
| CAS | 3696-22-8 |
| Molecular Weight (g/mol) | 197.21 |
| MDL Number | MFCD00007304 |
| SMILES | NC(=S)NC1=CC=C(C=C1)[N+]([O-])=O |
| Synonym | 1-4-nitrophenyl-2-thiourea,n-4-nitrophenyl thiourea,4-nitrophenyl thiourea,1-4-nitrophenyl thiourea,p-nitrophenyl thiourea,thiourea, 4-nitrophenyl,n-p-nitrophenyl thiourea,acmc-1cny6,4-nitro-phenyl-thiourea,n-4-nitrophenyl thiourea # |
| IUPAC Name | (4-nitrophenyl)thiourea |
| InChI Key | BLYAANPIHFKKMQ-UHFFFAOYSA-N |
| Molecular Formula | C7H7N3O2S |
Poly(styrene-divinylbenzene), aminomethylated, 1% cross-linked, 100-200 mesh
CAS: 89551-24-6 Molecular Formula: C7H9N Molecular Weight (g/mol): 107.156 MDL Number: MFCD00146442 InChI Key: WGQKYBSKWIADBV-UHFFFAOYSA-N Synonym: benzylamine,benzenemethanamine,monobenzylamine,alpha-aminotoluene,phenylmethyl amine,aminomethyl benzene,1-phenylmethanamine,moringine,n-benzylamine,phenylmethylamine PubChem CID: 7504 ChEBI: CHEBI:40538 IUPAC Name: phenylmethanamine SMILES: C1=CC=C(C=C1)CN
| PubChem CID | 7504 |
|---|---|
| CAS | 89551-24-6 |
| Molecular Weight (g/mol) | 107.156 |
| ChEBI | CHEBI:40538 |
| MDL Number | MFCD00146442 |
| SMILES | C1=CC=C(C=C1)CN |
| Synonym | benzylamine,benzenemethanamine,monobenzylamine,alpha-aminotoluene,phenylmethyl amine,aminomethyl benzene,1-phenylmethanamine,moringine,n-benzylamine,phenylmethylamine |
| IUPAC Name | phenylmethanamine |
| InChI Key | WGQKYBSKWIADBV-UHFFFAOYSA-N |
| Molecular Formula | C7H9N |
tert-Butylacetyl chloride, 98+%
CAS: 7065-46-5 Molecular Formula: C6H11ClO Molecular Weight (g/mol): 134.603 MDL Number: MFCD00000737 InChI Key: BUTKIHRNYUEGKB-UHFFFAOYSA-N Synonym: 3,3-dimethylbutyryl chloride,tert-butylacetyl chloride,t-butylacetyl chloride,butanoyl chloride, 3,3-dimethyl,3,3-dimethyl butyryl chloride,tert-butyl acetyl chloride,neohexanoyl chloride,t-butylacetylchloride,tertbutylacetylchloride,pubchem2093 PubChem CID: 81514 IUPAC Name: 3,3-dimethylbutanoyl chloride SMILES: CC(C)(C)CC(=O)Cl
| PubChem CID | 81514 |
|---|---|
| CAS | 7065-46-5 |
| Molecular Weight (g/mol) | 134.603 |
| MDL Number | MFCD00000737 |
| SMILES | CC(C)(C)CC(=O)Cl |
| Synonym | 3,3-dimethylbutyryl chloride,tert-butylacetyl chloride,t-butylacetyl chloride,butanoyl chloride, 3,3-dimethyl,3,3-dimethyl butyryl chloride,tert-butyl acetyl chloride,neohexanoyl chloride,t-butylacetylchloride,tertbutylacetylchloride,pubchem2093 |
| IUPAC Name | 3,3-dimethylbutanoyl chloride |
| InChI Key | BUTKIHRNYUEGKB-UHFFFAOYSA-N |
| Molecular Formula | C6H11ClO |
5-Nitrobenzimidazole, 98+%
CAS: 94-52-0 Molecular Formula: C7H5N3O2 Molecular Weight (g/mol): 163.14 MDL Number: MFCD00005604 InChI Key: XPAZGLFMMUODDK-UHFFFAOYSA-N Synonym: 5-nitrobenzimidazole,6-nitrobenzimidazole,5-nitro-1h-benzo d imidazole,5-nitro-1h-benzimidazole,1h-benzimidazole, 5-nitro,1h-benzimidazole, 6-nitro,6-nitro-benzimidazole,5 6-nitrobenzimidazole,benzimidazole, 5-nitro,benzimidazole, 6-nitro PubChem CID: 7195 IUPAC Name: 6-nitro-1H-benzimidazole SMILES: [O-][N+](=O)C1=CC=C2N=CNC2=C1
| PubChem CID | 7195 |
|---|---|
| CAS | 94-52-0 |
| Molecular Weight (g/mol) | 163.14 |
| MDL Number | MFCD00005604 |
| SMILES | [O-][N+](=O)C1=CC=C2N=CNC2=C1 |
| Synonym | 5-nitrobenzimidazole,6-nitrobenzimidazole,5-nitro-1h-benzo d imidazole,5-nitro-1h-benzimidazole,1h-benzimidazole, 5-nitro,1h-benzimidazole, 6-nitro,6-nitro-benzimidazole,5 6-nitrobenzimidazole,benzimidazole, 5-nitro,benzimidazole, 6-nitro |
| IUPAC Name | 6-nitro-1H-benzimidazole |
| InChI Key | XPAZGLFMMUODDK-UHFFFAOYSA-N |
| Molecular Formula | C7H5N3O2 |
2-n-Heptylfuran, 97%
CAS: 3777-71-7 Molecular Formula: C11H18O Molecular Weight (g/mol): 166.264 MDL Number: MFCD00051820 InChI Key: BHTUFJXTYNLISA-UHFFFAOYSA-N Synonym: 2-n-heptylfuran,furan, 2-heptyl,unii-7w55a39qxm,ccris 6901,fema no. 3401,2-heptyl furan,furan, heptyl PubChem CID: 19603 IUPAC Name: 2-heptylfuran SMILES: CCCCCCCC1=CC=CO1
| PubChem CID | 19603 |
|---|---|
| CAS | 3777-71-7 |
| Molecular Weight (g/mol) | 166.264 |
| MDL Number | MFCD00051820 |
| SMILES | CCCCCCCC1=CC=CO1 |
| Synonym | 2-n-heptylfuran,furan, 2-heptyl,unii-7w55a39qxm,ccris 6901,fema no. 3401,2-heptyl furan,furan, heptyl |
| IUPAC Name | 2-heptylfuran |
| InChI Key | BHTUFJXTYNLISA-UHFFFAOYSA-N |
| Molecular Formula | C11H18O |
(Perfluorocyclohexyl)methyl acrylate, 96%, stab. with 50ppm to 100ppm 4-methoxyphenol
CAS: 40677-94-9 Molecular Formula: C10H5F11O2 Molecular Weight (g/mol): 366.13 MDL Number: MFCD00080614 InChI Key: OZGWOALFBHODRB-UHFFFAOYSA-N Synonym: perfluorocyclohexylmethyl acrylate,perfluorocyclohexyl methyl acrylate,undecafluorocyclohexyl methyl prop-2-enoate,1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl methyl prop-2-enoate,acrylic acid 1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexylmethyl ester,1,2,2,3,3,4,4,5,5,6,6-undecakis fluoranyl cyclohexyl methyl prop-2-enoate,2-propenoic acid 1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl methyl ester PubChem CID: 2776049 IUPAC Name: (1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)methyl prop-2-enoate SMILES: C=CC(=O)OCC1(C(C(C(C(C1(F)F)(F)F)(F)F)(F)F)(F)F)F
| PubChem CID | 2776049 |
|---|---|
| CAS | 40677-94-9 |
| Molecular Weight (g/mol) | 366.13 |
| MDL Number | MFCD00080614 |
| SMILES | C=CC(=O)OCC1(C(C(C(C(C1(F)F)(F)F)(F)F)(F)F)(F)F)F |
| Synonym | perfluorocyclohexylmethyl acrylate,perfluorocyclohexyl methyl acrylate,undecafluorocyclohexyl methyl prop-2-enoate,1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl methyl prop-2-enoate,acrylic acid 1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexylmethyl ester,1,2,2,3,3,4,4,5,5,6,6-undecakis fluoranyl cyclohexyl methyl prop-2-enoate,2-propenoic acid 1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl methyl ester |
| IUPAC Name | (1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)methyl prop-2-enoate |
| InChI Key | OZGWOALFBHODRB-UHFFFAOYSA-N |
| Molecular Formula | C10H5F11O2 |